About ethane;2-phenylpropanenitrile
ethane;2-phenylpropanenitrile (PubChem CID 91366777) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is ethane;2-phenylpropanenitrile.
Molecular Properties
| Compound Name | ethane;2-phenylpropanenitrile |
| PubChem CID | 91366777 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | ethane;2-phenylpropanenitrile |
| SMILES | CC.CC.CC.CC(C#N)c1ccccc1 |
| InChI | InChI=1S/C9H9N.3C2H6/c1-8(7-10)9-5-3-2-4-6-9;3*1-2/h2-6,8H,1H3;3*1-2H3 |
| InChIKey | KMFXFNLADXOTAC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-phenylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenylpropanenitrile?
The IUPAC name of ethane;2-phenylpropanenitrile (CID 91366777) is ethane;2-phenylpropanenitrile.
What is the SMILES notation for ethane;2-phenylpropanenitrile?
The canonical SMILES for ethane;2-phenylpropanenitrile is CC.CC.CC.CC(C#N)c1ccccc1.
What is the InChIKey of ethane;2-phenylpropanenitrile?
The InChIKey is KMFXFNLADXOTAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.3C2H6/c1-8(7-10)9-5-3-2-4-6-9;3*1-2/h2-6,8H,1H3;3*1-2H3.
What are the key properties of ethane;2-phenylpropanenitrile?
ethane;2-phenylpropanenitrile has a molecular weight of 221.39 g/mol, XLogP of 5.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenylpropanenitrile is sourced from PubChem (CID 91366777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).