C30H18O4 — CID 22140195
3-[3-carboxy-5-(2-phenylethynyl)phenyl]-5-(2-phenylethynyl)benzoic acid (PubChem CID 22140195) has the molecular formula C30H18O4 and a molecular weight of 442.47 g/mol. Its IUPAC name is 3-[3-carboxy-5-(2-phenylethynyl)phenyl]-5-(2-phenylethynyl)benzoic acid.
| Compound Name | 3-[3-carboxy-5-(2-phenylethynyl)phenyl]-5-(2-phenylethynyl)benzoic acid |
|---|---|
| PubChem CID | 22140195 |
| Molecular Formula | C30H18O4 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-[3-carboxy-5-(2-phenylethynyl)phenyl]-5-(2-phenylethynyl)benzoic acid |
| SMILES | O=C(O)c1cc(C#Cc2ccccc2)cc(-c2cc(C#Cc3ccccc3)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C30H18O4/c31-29(32)27-17-23(13-11-21-7-3-1-4-8-21)15-25(19-27)26-16-24(18-28(20-26)30(33)34)14-12-22-9-5-2-6-10-22/h1-10,15-20H,(H,31,32)(H,33,34) |
| InChIKey | NRXCPOXNUQCKAM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|