C28H18O4 — CID 175949462
5-[2-(3,5-diphenylphenyl)ethynyl]benzene-1,3-dicarboxylic acid (PubChem CID 175949462) has the molecular formula C28H18O4 and a molecular weight of 418.45 g/mol. Its IUPAC name is 5-[2-(3,5-diphenylphenyl)ethynyl]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[2-(3,5-diphenylphenyl)ethynyl]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175949462 |
| Molecular Formula | C28H18O4 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-[2-(3,5-diphenylphenyl)ethynyl]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C#Cc2cc(-c3ccccc3)cc(-c3ccccc3)c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C28H18O4/c29-27(30)25-15-20(16-26(18-25)28(31)32)12-11-19-13-23(21-7-3-1-4-8-21)17-24(14-19)22-9-5-2-6-10-22/h1-10,13-18H,(H,29,30)(H,31,32) |
| InChIKey | ZEFUBJSOZXGPQS-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|