C22H14O4 — CID 22140387
4-[3-(4-carboxyphenyl)-5-ethynylphenyl]benzoic acid (PubChem CID 22140387) has the molecular formula C22H14O4 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-[3-(4-carboxyphenyl)-5-ethynylphenyl]benzoic acid.
| Compound Name | 4-[3-(4-carboxyphenyl)-5-ethynylphenyl]benzoic acid |
|---|---|
| PubChem CID | 22140387 |
| Molecular Formula | C22H14O4 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-[3-(4-carboxyphenyl)-5-ethynylphenyl]benzoic acid |
| SMILES | C#Cc1cc(-c2ccc(C(=O)O)cc2)cc(-c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C22H14O4/c1-2-14-11-19(15-3-7-17(8-4-15)21(23)24)13-20(12-14)16-5-9-18(10-6-16)22(25)26/h1,3-13H,(H,23,24)(H,25,26) |
| InChIKey | BCRIJGZIMZBGFO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|