C25H20O8P2 — CID 170897746
4-[3,5-bis(4-phosphonophenyl)phenyl]benzoic acid (PubChem CID 170897746) has the molecular formula C25H20O8P2 and a molecular weight of 510.38 g/mol. Its IUPAC name is 4-[3,5-bis(4-phosphonophenyl)phenyl]benzoic acid.
| Compound Name | 4-[3,5-bis(4-phosphonophenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 170897746 |
| Molecular Formula | C25H20O8P2 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | 4-[3,5-bis(4-phosphonophenyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(-c3ccc(P(=O)(O)O)cc3)cc(-c3ccc(P(=O)(O)O)cc3)c2)cc1 |
| InChI | InChI=1S/C25H20O8P2/c26-25(27)19-3-1-16(2-4-19)20-13-21(17-5-9-23(10-6-17)34(28,29)30)15-22(14-20)18-7-11-24(12-8-18)35(31,32)33/h1-15H,(H,26,27)(H2,28,29,30)(H2,31,32,33) |
| InChIKey | WHNVJPSHXKPYSH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|