C48H28F6O8 — CID 135326305
4-[3-[4-[3,5-bis(4-carboxyphenyl)phenyl]-2,5-bis(trifluoromethyl)phenyl]-5-(4-carboxyphenyl)phenyl]benzoic acid (PubChem CID 135326305) has the molecular formula C48H28F6O8 and a molecular weight of 846.73 g/mol. Its IUPAC name is 4-[3-[4-[3,5-bis(4-carboxyphenyl)phenyl]-2,5-bis(trifluoromethyl)phenyl]-5-(4-carboxyphenyl)phenyl]benzoic acid.
| Compound Name | 4-[3-[4-[3,5-bis(4-carboxyphenyl)phenyl]-2,5-bis(trifluoromethyl)phenyl]-5-(4-carboxyphenyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 135326305 |
| Molecular Formula | C48H28F6O8 |
| Molecular Weight | 846.73 g/mol |
| Exact Mass | 846.17 |
| IUPAC Name | 4-[3-[4-[3,5-bis(4-carboxyphenyl)phenyl]-2,5-bis(trifluoromethyl)phenyl]-5-(4-carboxyphenyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(-c3ccc(C(=O)O)cc3)cc(-c3cc(C(F)(F)F)c(-c4cc(-c5ccc(C(=O)O)cc5)cc(-c5ccc(C(=O)O)cc5)c4)cc3C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C48H28F6O8/c49-47(50,51)41-24-40(38-21-35(27-5-13-31(14-6-27)45(59)60)18-36(22-38)28-7-15-32(16-8-28)46(61)62)42(48(52,53)54)23-39(41)37-19-33(25-1-9-29(10-2-25)43(55)56)17-34(20-37)26-3-11-30(12-4-26)44(57)58/h1-24H,(H,55,56)(H,57,58)(H,59,60)(H,61,62) |
| InChIKey | MCULFEPHVJZIEE-UHFFFAOYSA-N |
| XLogP | 12.52 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.73 |
| LogP ≤ 5 | 12.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |