C21H14F3NO5 — CID 175730003
3-amino-4-[3-(4-carboxyphenyl)-5-(trifluoromethoxy)phenyl]benzoic acid (PubChem CID 175730003) has the molecular formula C21H14F3NO5 and a molecular weight of 417.34 g/mol. Its IUPAC name is 3-amino-4-[3-(4-carboxyphenyl)-5-(trifluoromethoxy)phenyl]benzoic acid.
| Compound Name | 3-amino-4-[3-(4-carboxyphenyl)-5-(trifluoromethoxy)phenyl]benzoic acid |
|---|---|
| PubChem CID | 175730003 |
| Molecular Formula | C21H14F3NO5 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 3-amino-4-[3-(4-carboxyphenyl)-5-(trifluoromethoxy)phenyl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1-c1cc(OC(F)(F)F)cc(-c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C21H14F3NO5/c22-21(23,24)30-16-8-14(11-1-3-12(4-2-11)19(26)27)7-15(9-16)17-6-5-13(20(28)29)10-18(17)25/h1-10H,25H2,(H,26,27)(H,28,29) |
| InChIKey | QXKPBBBXXYOIBH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|