C15H9F3O4 — CID 53226200
3-(4-carboxyphenyl)-5-(trifluoromethyl)benzoic acid (PubChem CID 53226200) has the molecular formula C15H9F3O4 and a molecular weight of 310.23 g/mol. Its IUPAC name is 3-(4-carboxyphenyl)-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-(4-carboxyphenyl)-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 53226200 |
| Molecular Formula | C15H9F3O4 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 3-(4-carboxyphenyl)-5-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(C(=O)O)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C15H9F3O4/c16-15(17,18)12-6-10(5-11(7-12)14(21)22)8-1-3-9(4-2-8)13(19)20/h1-7H,(H,19,20)(H,21,22) |
| InChIKey | ZSACUTOXWGVAFC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |