C16H7F9O2 — CID 176657557
4-[2,3,4-tris(trifluoromethyl)phenyl]benzoic acid (PubChem CID 176657557) has the molecular formula C16H7F9O2 and a molecular weight of 402.21 g/mol. Its IUPAC name is 4-[2,3,4-tris(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 4-[2,3,4-tris(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 176657557 |
| Molecular Formula | C16H7F9O2 |
| Molecular Weight | 402.21 g/mol |
| Exact Mass | 402.03 |
| IUPAC Name | 4-[2,3,4-tris(trifluoromethyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C(F)(F)F)c(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H7F9O2/c17-14(18,19)10-6-5-9(7-1-3-8(4-2-7)13(26)27)11(15(20,21)22)12(10)16(23,24)25/h1-6H,(H,26,27) |
| InChIKey | HYHZXSNEOCMHEX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.21 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |