C17H9F3O8 — CID 69217251
4-(3,4-dicarboxyphenyl)-3-(trifluoromethyl)phthalic acid (PubChem CID 69217251) has the molecular formula C17H9F3O8 and a molecular weight of 398.25 g/mol. Its IUPAC name is 4-(3,4-dicarboxyphenyl)-3-(trifluoromethyl)phthalic acid.
| Compound Name | 4-(3,4-dicarboxyphenyl)-3-(trifluoromethyl)phthalic acid |
|---|---|
| PubChem CID | 69217251 |
| Molecular Formula | C17H9F3O8 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | 4-(3,4-dicarboxyphenyl)-3-(trifluoromethyl)phthalic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C(=O)O)c(C(=O)O)c2C(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C17H9F3O8/c18-17(19,20)12-7(3-4-9(14(23)24)11(12)16(27)28)6-1-2-8(13(21)22)10(5-6)15(25)26/h1-5H,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | ZDZPOLPAHIYCHK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |