C17H10F2O8 — CID 150972668
4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid (PubChem CID 150972668) has the molecular formula C17H10F2O8 and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid.
| Compound Name | 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid |
|---|---|
| PubChem CID | 150972668 |
| Molecular Formula | C17H10F2O8 |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 380.03 |
| IUPAC Name | 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C(=O)O)c(C(=O)O)c2C(F)F)cc1C(=O)O |
| InChI | InChI=1S/C17H10F2O8/c18-13(19)11-7(3-4-9(15(22)23)12(11)17(26)27)6-1-2-8(14(20)21)10(5-6)16(24)25/h1-5,13H,(H,20,21)(H,22,23)(H,24,25)(H,26,27) |
| InChIKey | LOLBLCBTNZZVEE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |