4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid

C17H10F2O8 — CID 150972668

IUPAC4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid
SMILESO=C(O)c1ccc(-c2ccc(C(=O)O)c(C(=O)O)c2C(F)F)cc1C(=O)O
InChIInChI=1S/C17H10F2O8/c18-13(19)11-7(3-4-9(15(22)23)12(11)17(26)27)6-1-2-8(14(20)21)10(5-6)16(24)25/h1-5,13H,(H,20,21)(H,22,23)(H,24,25)(H,26,27)
InChIKeyLOLBLCBTNZZVEE-UHFFFAOYSA-N
MW380.26 g/mol
LogP3.08
Rot. Bonds6

About 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid

4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid (PubChem CID 150972668) has the molecular formula C17H10F2O8 and a molecular weight of 380.26 g/mol. Its IUPAC name is 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid.

Molecular Properties

Compound Name4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid
PubChem CID150972668
Molecular FormulaC17H10F2O8
Molecular Weight380.26 g/mol
Exact Mass380.03
IUPAC Name4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid
SMILESO=C(O)c1ccc(-c2ccc(C(=O)O)c(C(=O)O)c2C(F)F)cc1C(=O)O
InChIInChI=1S/C17H10F2O8/c18-13(19)11-7(3-4-9(15(22)23)12(11)17(26)27)6-1-2-8(14(20)21)10(5-6)16(24)25/h1-5,13H,(H,20,21)(H,22,23)(H,24,25)(H,26,27)
InChIKeyLOLBLCBTNZZVEE-UHFFFAOYSA-N
XLogP3.08
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500380.26
LogP ≤ 53.08
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid?
The IUPAC name of 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid (CID 150972668) is 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid.
What is the SMILES notation for 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid?
The canonical SMILES for 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid is O=C(O)c1ccc(-c2ccc(C(=O)O)c(C(=O)O)c2C(F)F)cc1C(=O)O.
What is the InChIKey of 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid?
The InChIKey is LOLBLCBTNZZVEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F2O8/c18-13(19)11-7(3-4-9(15(22)23)12(11)17(26)27)6-1-2-8(14(20)21)10(5-6)16(24)25/h1-5,13H,(H,20,21)(H,22,23)(H,24,25)(H,26,27).
What are the key properties of 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid?
4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid has a molecular weight of 380.26 g/mol, XLogP of 3.08, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-dicarboxyphenyl)-3-(difluoromethyl)phthalic acid is sourced from PubChem (CID 150972668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).