2-acetyl-4-(3,4-diacetylphenyl)benzoic acid

C19H16O5 — CID 54415638

IUPAC2-acetyl-4-(3,4-diacetylphenyl)benzoic acid
SMILESCC(=O)c1ccc(-c2ccc(C(=O)O)c(C(C)=O)c2)cc1C(C)=O
InChIInChI=1S/C19H16O5/c1-10(20)15-6-4-13(8-17(15)11(2)21)14-5-7-16(19(23)24)18(9-14)12(3)22/h4-9H,1-3H3,(H,23,24)
InChIKeyVXEZVCINIDUGBL-UHFFFAOYSA-N
MW324.33 g/mol
LogP3.66
Rot. Bonds5

About 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid

2-acetyl-4-(3,4-diacetylphenyl)benzoic acid (PubChem CID 54415638) has the molecular formula C19H16O5 and a molecular weight of 324.33 g/mol. Its IUPAC name is 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid.

Molecular Properties

Compound Name2-acetyl-4-(3,4-diacetylphenyl)benzoic acid
PubChem CID54415638
Molecular FormulaC19H16O5
Molecular Weight324.33 g/mol
Exact Mass324.10
IUPAC Name2-acetyl-4-(3,4-diacetylphenyl)benzoic acid
SMILESCC(=O)c1ccc(-c2ccc(C(=O)O)c(C(C)=O)c2)cc1C(C)=O
InChIInChI=1S/C19H16O5/c1-10(20)15-6-4-13(8-17(15)11(2)21)14-5-7-16(19(23)24)18(9-14)12(3)22/h4-9H,1-3H3,(H,23,24)
InChIKeyVXEZVCINIDUGBL-UHFFFAOYSA-N
XLogP3.66
TPSA88.51 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.33
LogP ≤ 53.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid?
The IUPAC name of 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid (CID 54415638) is 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid.
What is the SMILES notation for 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid?
The canonical SMILES for 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid is CC(=O)c1ccc(-c2ccc(C(=O)O)c(C(C)=O)c2)cc1C(C)=O.
What is the InChIKey of 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid?
The InChIKey is VXEZVCINIDUGBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O5/c1-10(20)15-6-4-13(8-17(15)11(2)21)14-5-7-16(19(23)24)18(9-14)12(3)22/h4-9H,1-3H3,(H,23,24).
What are the key properties of 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid?
2-acetyl-4-(3,4-diacetylphenyl)benzoic acid has a molecular weight of 324.33 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyl-4-(3,4-diacetylphenyl)benzoic acid is sourced from PubChem (CID 54415638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).