C15H8F6O2 — CID 87400968
4-[2,3-bis(trifluoromethyl)phenyl]benzoic acid (PubChem CID 87400968) has the molecular formula C15H8F6O2 and a molecular weight of 334.22 g/mol. Its IUPAC name is 4-[2,3-bis(trifluoromethyl)phenyl]benzoic acid.
| Compound Name | 4-[2,3-bis(trifluoromethyl)phenyl]benzoic acid |
|---|---|
| PubChem CID | 87400968 |
| Molecular Formula | C15H8F6O2 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 4-[2,3-bis(trifluoromethyl)phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(C(F)(F)F)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8F6O2/c16-14(17,18)11-3-1-2-10(12(11)15(19,20)21)8-4-6-9(7-5-8)13(22)23/h1-7H,(H,22,23) |
| InChIKey | MESXUKZUYLQQMM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |