C45H30O4 — CID 90463094
4-[4-[3,5-bis[4-(4-formylphenyl)phenyl]phenyl]phenyl]benzoic acid (PubChem CID 90463094) has the molecular formula C45H30O4 and a molecular weight of 634.73 g/mol. Its IUPAC name is 4-[4-[3,5-bis[4-(4-formylphenyl)phenyl]phenyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[3,5-bis[4-(4-formylphenyl)phenyl]phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 90463094 |
| Molecular Formula | C45H30O4 |
| Molecular Weight | 634.73 g/mol |
| Exact Mass | 634.21 |
| IUPAC Name | 4-[4-[3,5-bis[4-(4-formylphenyl)phenyl]phenyl]phenyl]benzoic acid |
| SMILES | O=Cc1ccc(-c2ccc(-c3cc(-c4ccc(-c5ccc(C=O)cc5)cc4)cc(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C45H30O4/c46-28-30-1-5-32(6-2-30)34-9-15-38(16-10-34)42-25-43(39-17-11-35(12-18-39)33-7-3-31(29-47)4-8-33)27-44(26-42)40-19-13-36(14-20-40)37-21-23-41(24-22-37)45(48)49/h1-29H,(H,48,49) |
| InChIKey | XHNUYWVQFIWLDF-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.73 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|