C35H28O5 — CID 159902249
(4-formylphenyl) 4-(4-methylphenyl)benzoate;4-(4-methylphenyl)benzoic acid (PubChem CID 159902249) has the molecular formula C35H28O5 and a molecular weight of 528.60 g/mol. Its IUPAC name is (4-formylphenyl) 4-(4-methylphenyl)benzoate;4-(4-methylphenyl)benzoic acid.
| Compound Name | (4-formylphenyl) 4-(4-methylphenyl)benzoate;4-(4-methylphenyl)benzoic acid |
|---|---|
| PubChem CID | 159902249 |
| Molecular Formula | C35H28O5 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | (4-formylphenyl) 4-(4-methylphenyl)benzoate;4-(4-methylphenyl)benzoic acid |
| SMILES | Cc1ccc(-c2ccc(C(=O)O)cc2)cc1.Cc1ccc(-c2ccc(C(=O)Oc3ccc(C=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H16O3.C14H12O2/c1-15-2-6-17(7-3-15)18-8-10-19(11-9-18)21(23)24-20-12-4-16(14-22)5-13-20;1-10-2-4-11(5-3-10)12-6-8-13(9-7-12)14(15)16/h2-14H,1H3;2-9H,1H3,(H,15,16) |
| InChIKey | NWCNYKPBENKSBO-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|