C48H45NO7 — CID 161397885
(4-formylphenyl) 4-(4-methylphenyl)benzoate;[4-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-(4-methylphenyl)benzoate (PubChem CID 161397885) has the molecular formula C48H45NO7 and a molecular weight of 747.89 g/mol. Its IUPAC name is (4-formylphenyl) 4-(4-methylphenyl)benzoate;[4-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-(4-methylphenyl)benzoate.
| Compound Name | (4-formylphenyl) 4-(4-methylphenyl)benzoate;[4-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-(4-methylphenyl)benzoate |
|---|---|
| PubChem CID | 161397885 |
| Molecular Formula | C48H45NO7 |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 747.32 |
| IUPAC Name | (4-formylphenyl) 4-(4-methylphenyl)benzoate;[4-[[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]phenyl] 4-(4-methylphenyl)benzoate |
| SMILES | Cc1ccc(-c2ccc(C(=O)Oc3ccc(C=O)cc3)cc2)cc1.Cc1ccc(-c2ccc(C(=O)Oc3ccc(CNCC(=O)OC(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H29NO4.C21H16O3/c1-19-5-9-21(10-6-19)22-11-13-23(14-12-22)26(30)31-24-15-7-20(8-16-24)17-28-18-25(29)32-27(2,3)4;1-15-2-6-17(7-3-15)18-8-10-19(11-9-18)21(23)24-20-12-4-16(14-22)5-13-20/h5-16,28H,17-18H2,1-4H3;2-14H,1H3 |
| InChIKey | VTVQNAAQZQUMOD-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|