C21H14O3 — CID 141451191
3,5-bis(4-formylphenyl)benzaldehyde (PubChem CID 141451191) has the molecular formula C21H14O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3,5-bis(4-formylphenyl)benzaldehyde.
| Compound Name | 3,5-bis(4-formylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 141451191 |
| Molecular Formula | C21H14O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3,5-bis(4-formylphenyl)benzaldehyde |
| SMILES | O=Cc1ccc(-c2cc(C=O)cc(-c3ccc(C=O)cc3)c2)cc1 |
| InChI | InChI=1S/C21H14O3/c22-12-15-1-5-18(6-2-15)20-9-17(14-24)10-21(11-20)19-7-3-16(13-23)4-8-19/h1-14H |
| InChIKey | KHAUIFXBTYZWBJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|