C9H6O — CID 175350656
acetylene;bicyclo[3.1.0]hexa-1(6),2,4-triene-3-carbaldehyde (PubChem CID 175350656) has the molecular formula C9H6O and a molecular weight of 130.15 g/mol. Its IUPAC name is acetylene;bicyclo[3.1.0]hexa-1(6),2,4-triene-3-carbaldehyde.
| Compound Name | acetylene;bicyclo[3.1.0]hexa-1(6),2,4-triene-3-carbaldehyde |
|---|---|
| PubChem CID | 175350656 |
| Molecular Formula | C9H6O |
| Molecular Weight | 130.15 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | acetylene;bicyclo[3.1.0]hexa-1(6),2,4-triene-3-carbaldehyde |
| SMILES | C#C.O=Cc1cc2cc-2c1 |
| InChI | InChI=1S/C7H4O.C2H2/c8-4-5-1-6-3-7(6)2-5;1-2/h1-4H;1-2H |
| InChIKey | KSUMZYPRCOWONV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|