About terephthalaldehyde
terephthalaldehyde (PubChem CID 12173) has the molecular formula C8H6O2
and a molecular weight of 134.13 g/mol. Its IUPAC name is terephthalaldehyde.
Molecular Properties
| Compound Name | terephthalaldehyde |
| PubChem CID | 12173 |
| Molecular Formula | C8H6O2 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | terephthalaldehyde |
| SMILES | O=Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C8H6O2/c9-5-7-1-2-8(6-10)4-3-7/h1-6H |
| InChIKey | KUCOHFSKRZZVRO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze terephthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of terephthalaldehyde?
The IUPAC name of terephthalaldehyde (CID 12173) is terephthalaldehyde.
What is the SMILES notation for terephthalaldehyde?
The canonical SMILES for terephthalaldehyde is O=Cc1ccc(C=O)cc1.
What is the InChIKey of terephthalaldehyde?
The InChIKey is KUCOHFSKRZZVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O2/c9-5-7-1-2-8(6-10)4-3-7/h1-6H.
What are the key properties of terephthalaldehyde?
terephthalaldehyde has a molecular weight of 134.13 g/mol, XLogP of 1.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for terephthalaldehyde is sourced from PubChem (CID 12173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).