C25H24O7S — CID 10195432
4-[(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid (PubChem CID 10195432) has the molecular formula C25H24O7S and a molecular weight of 468.53 g/mol. Its IUPAC name is 4-[(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid.
| Compound Name | 4-[(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
|---|---|
| PubChem CID | 10195432 |
| Molecular Formula | C25H24O7S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 4-[(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]prop-2-enoyl]benzoic acid |
| SMILES | COc1cc(OCC(CO)CO)c(-c2cccs2)cc1/C=C/C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H24O7S/c1-31-22-12-23(32-15-16(13-26)14-27)20(24-3-2-10-33-24)11-19(22)8-9-21(28)17-4-6-18(7-5-17)25(29)30/h2-12,16,26-27H,13-15H2,1H3,(H,29,30)/b9-8+ |
| InChIKey | SVNVTGJFWCUDHN-CMDGGOBGSA-N |
| XLogP | 4.00 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|