C27H31NO7S — CID 142259455
aminomethyl formate;(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]-1-(4-methylphenyl)prop-2-en-1-one (PubChem CID 142259455) has the molecular formula C27H31NO7S and a molecular weight of 513.61 g/mol. Its IUPAC name is aminomethyl formate;(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]-1-(4-methylphenyl)prop-2-en-1-one.
| Compound Name | aminomethyl formate;(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]-1-(4-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 142259455 |
| Molecular Formula | C27H31NO7S |
| Molecular Weight | 513.61 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | aminomethyl formate;(E)-3-[4-[3-hydroxy-2-(hydroxymethyl)propoxy]-2-methoxy-5-thiophen-2-ylphenyl]-1-(4-methylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OCC(CO)CO)c(-c2cccs2)cc1/C=C/C(=O)c1ccc(C)cc1.NCOC=O |
| InChI | InChI=1S/C25H26O5S.C2H5NO2/c1-17-5-7-19(8-6-17)22(28)10-9-20-12-21(25-4-3-11-31-25)24(13-23(20)29-2)30-16-18(14-26)15-27;3-1-5-2-4/h3-13,18,26-27H,14-16H2,1-2H3;2H,1,3H2/b10-9+; |
| InChIKey | UEOGSDQSHSDMOZ-RRABGKBLSA-N |
| XLogP | 3.68 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.61 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|