C26H22N2O3S2 — CID 58693604
(E)-1-(4-aminosulfanylphenyl)-3-[4-methoxy-2-(pyridin-2-ylmethoxy)-5-thiophen-2-ylphenyl]prop-2-en-1-one (PubChem CID 58693604) has the molecular formula C26H22N2O3S2 and a molecular weight of 474.61 g/mol. Its IUPAC name is (E)-1-(4-aminosulfanylphenyl)-3-[4-methoxy-2-(pyridin-2-ylmethoxy)-5-thiophen-2-ylphenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-aminosulfanylphenyl)-3-[4-methoxy-2-(pyridin-2-ylmethoxy)-5-thiophen-2-ylphenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 58693604 |
| Molecular Formula | C26H22N2O3S2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (E)-1-(4-aminosulfanylphenyl)-3-[4-methoxy-2-(pyridin-2-ylmethoxy)-5-thiophen-2-ylphenyl]prop-2-en-1-one |
| SMILES | COc1cc(OCc2ccccn2)c(/C=C/C(=O)c2ccc(SN)cc2)cc1-c1cccs1 |
| InChI | InChI=1S/C26H22N2O3S2/c1-30-25-16-24(31-17-20-5-2-3-13-28-20)19(15-22(25)26-6-4-14-32-26)9-12-23(29)18-7-10-21(33-27)11-8-18/h2-16H,17,27H2,1H3/b12-9+ |
| InChIKey | SRDNNTPORGJFNC-FMIVXFBMSA-N |
| XLogP | 6.26 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|