C33H30N2O6 — CID 142718830
1,7-bis[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 142718830) has the molecular formula C33H30N2O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is 1,7-bis[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | 1,7-bis[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 142718830 |
| Molecular Formula | C33H30N2O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 1,7-bis[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | COc1cc(OCc2ccccn2)ccc1C=CC(=O)CC(=O)C=Cc1ccc(OCc2ccccn2)cc1OC |
| InChI | InChI=1S/C33H30N2O6/c1-38-32-20-30(40-22-26-7-3-5-17-34-26)15-11-24(32)9-13-28(36)19-29(37)14-10-25-12-16-31(21-33(25)39-2)41-23-27-8-4-6-18-35-27/h3-18,20-21H,19,22-23H2,1-2H3 |
| InChIKey | PATWOZJJXDYCMK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 96.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|