C29H26N2O3 — CID 126635711
(1E,6E)-7-(1H-indol-3-yl)-1-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]-5-methylidenehepta-1,6-dien-3-one (PubChem CID 126635711) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is (1E,6E)-7-(1H-indol-3-yl)-1-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]-5-methylidenehepta-1,6-dien-3-one.
| Compound Name | (1E,6E)-7-(1H-indol-3-yl)-1-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]-5-methylidenehepta-1,6-dien-3-one |
|---|---|
| PubChem CID | 126635711 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (1E,6E)-7-(1H-indol-3-yl)-1-[2-methoxy-4-(pyridin-2-ylmethoxy)phenyl]-5-methylidenehepta-1,6-dien-3-one |
| SMILES | C=C(/C=C/c1c[nH]c2ccccc12)CC(=O)/C=C/c1ccc(OCc2ccccn2)cc1OC |
| InChI | InChI=1S/C29H26N2O3/c1-21(10-11-23-19-31-28-9-4-3-8-27(23)28)17-25(32)14-12-22-13-15-26(18-29(22)33-2)34-20-24-7-5-6-16-30-24/h3-16,18-19,31H,1,17,20H2,2H3/b11-10+,14-12+ |
| InChIKey | AAWUDWNEJRTFSS-CYZWUHAYSA-N |
| XLogP | 6.39 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|