C27H22N2O3 — CID 142769517
(1Z)-1-(1H-indol-3-yl)-1-[3-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 142769517) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is (1Z)-1-(1H-indol-3-yl)-1-[3-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1Z)-1-(1H-indol-3-yl)-1-[3-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 142769517 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (1Z)-1-(1H-indol-3-yl)-1-[3-(pyridin-2-ylmethoxy)phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | C=CC(=O)CC(=O)/C=C(/c1cccc(OCc2ccccn2)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H22N2O3/c1-2-21(30)15-22(31)16-25(26-17-29-27-12-4-3-11-24(26)27)19-8-7-10-23(14-19)32-18-20-9-5-6-13-28-20/h2-14,16-17,29H,1,15,18H2/b25-16- |
| InChIKey | NQIHTVJVCZPCKT-XYGWBWBKSA-N |
| XLogP | 5.29 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|