C26H24N2O6S — CID 21082465
4-[2-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-hydroxybenzenesulfonamide (PubChem CID 21082465) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is 4-[2-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-hydroxybenzenesulfonamide.
| Compound Name | 4-[2-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 21082465 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-[2-[2,4-dimethoxy-5-(1-methylindol-2-yl)phenyl]prop-2-enoyl]-N-hydroxybenzenesulfonamide |
| SMILES | C=C(C(=O)c1ccc(S(=O)(=O)NO)cc1)c1cc(-c2cc3ccccc3n2C)c(OC)cc1OC |
| InChI | InChI=1S/C26H24N2O6S/c1-16(26(29)17-9-11-19(12-10-17)35(31,32)27-30)20-14-21(25(34-4)15-24(20)33-3)23-13-18-7-5-6-8-22(18)28(23)2/h5-15,27,30H,1H2,2-4H3 |
| InChIKey | BDXCOXUBFMDNNQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|