C19H20N2O4S — CID 47013165
methyl 4-(3-indol-1-ylpropylsulfamoyl)benzoate (PubChem CID 47013165) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is methyl 4-(3-indol-1-ylpropylsulfamoyl)benzoate.
| Compound Name | methyl 4-(3-indol-1-ylpropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 47013165 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl 4-(3-indol-1-ylpropylsulfamoyl)benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)NCCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-25-19(22)16-7-9-17(10-8-16)26(23,24)20-12-4-13-21-14-11-15-5-2-3-6-18(15)21/h2-3,5-11,14,20H,4,12-13H2,1H3 |
| InChIKey | QWRCORZACNDUKR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|