C25H21N3O4S — CID 108780319
4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-indol-1-ylethyl)benzenesulfonamide (PubChem CID 108780319) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-indol-1-ylethyl)benzenesulfonamide.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-indol-1-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 108780319 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-indol-1-ylethyl)benzenesulfonamide |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(S(=O)(=O)NCCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C25H21N3O4S/c29-24-21-6-2-3-7-22(21)25(30)28(24)17-18-9-11-20(12-10-18)33(31,32)26-14-16-27-15-13-19-5-1-4-8-23(19)27/h1-13,15,26H,14,16-17H2 |
| InChIKey | QGVCJCJGFPEVOR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|