C15H11Cl2NO7S2 — CID 159849106
4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonyl chloride;sulfurochloridic acid (PubChem CID 159849106) has the molecular formula C15H11Cl2NO7S2 and a molecular weight of 452.29 g/mol. Its IUPAC name is 4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonyl chloride;sulfurochloridic acid.
| Compound Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonyl chloride;sulfurochloridic acid |
|---|---|
| PubChem CID | 159849106 |
| Molecular Formula | C15H11Cl2NO7S2 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 450.94 |
| IUPAC Name | 4-[(1,3-dioxoisoindol-2-yl)methyl]benzenesulfonyl chloride;sulfurochloridic acid |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(S(=O)(=O)Cl)cc1.O=S(=O)(O)Cl |
| InChI | InChI=1S/C15H10ClNO4S.ClHO3S/c16-22(20,21)11-7-5-10(6-8-11)9-17-14(18)12-3-1-2-4-13(12)15(17)19;1-5(2,3)4/h1-8H,9H2;(H,2,3,4) |
| InChIKey | NPRTYVZPQBMYAS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|