C38H36N2O7S2 — CID 70314338
2-[[4-[8-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]sulfonyloctylsulfinyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 70314338) has the molecular formula C38H36N2O7S2 and a molecular weight of 696.85 g/mol. Its IUPAC name is 2-[[4-[8-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]sulfonyloctylsulfinyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[8-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]sulfonyloctylsulfinyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70314338 |
| Molecular Formula | C38H36N2O7S2 |
| Molecular Weight | 696.85 g/mol |
| Exact Mass | 696.20 |
| IUPAC Name | 2-[[4-[8-[4-[(1,3-dioxoisoindol-2-yl)methyl]phenyl]sulfonyloctylsulfinyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1ccc(S(=O)CCCCCCCCS(=O)(=O)c2ccc(CN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C38H36N2O7S2/c41-35-31-11-5-6-12-32(31)36(42)39(35)25-27-15-19-29(20-16-27)48(45)23-9-3-1-2-4-10-24-49(46,47)30-21-17-28(18-22-30)26-40-37(43)33-13-7-8-14-34(33)38(40)44/h5-8,11-22H,1-4,9-10,23-26H2 |
| InChIKey | GEJLXDMOSWJBTI-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 125.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.85 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|