C20H16N2O4S — CID 113082483
N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]benzenesulfonamide (PubChem CID 113082483) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]benzenesulfonamide.
| Compound Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 113082483 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethyl]benzenesulfonamide |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O4S/c23-19-16-10-4-6-14-7-5-11-17(18(14)16)20(24)22(19)13-12-21-27(25,26)15-8-2-1-3-9-15/h1-11,21H,12-13H2 |
| InChIKey | JVCQEBSPPVSZEA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|