C14H10KNO5S — CID 58332797
potassium 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethanesulfonate (PubChem CID 58332797) has the molecular formula C14H10KNO5S and a molecular weight of 343.40 g/mol. Its IUPAC name is potassium 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethanesulfonate.
| Compound Name | potassium 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethanesulfonate |
|---|---|
| PubChem CID | 58332797 |
| Molecular Formula | C14H10KNO5S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | potassium 2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethanesulfonate |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C14H11NO5S.K/c16-13-10-5-1-3-9-4-2-6-11(12(9)10)14(17)15(13)7-8-21(18,19)20;/h1-6H,7-8H2,(H,18,19,20);/q;+1/p-1 |
| InChIKey | HEFCMGSCZWDSLM-UHFFFAOYSA-M |
| XLogP | -2.02 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|