C18H19NO7S — CID 178103850
2-[2-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]ethanesulfonic acid (PubChem CID 178103850) has the molecular formula C18H19NO7S and a molecular weight of 393.42 g/mol. Its IUPAC name is 2-[2-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]ethanesulfonic acid.
| Compound Name | 2-[2-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 178103850 |
| Molecular Formula | C18H19NO7S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[2-[2-(1,3-dioxobenzo[de]isoquinolin-2-yl)ethoxy]ethoxy]ethanesulfonic acid |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1CCOCCOCCS(=O)(=O)O |
| InChI | InChI=1S/C18H19NO7S/c20-17-14-5-1-3-13-4-2-6-15(16(13)14)18(21)19(17)7-8-25-9-10-26-11-12-27(22,23)24/h1-6H,7-12H2,(H,22,23,24) |
| InChIKey | UVXCITMEULEZBE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|