C28H17N2O10S2- — CID 176556728
2-[6,8,17,19-tetraoxo-18-(2-sulfoethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl]ethanesulfonate (PubChem CID 176556728) has the molecular formula C28H17N2O10S2- and a molecular weight of 605.58 g/mol. Its IUPAC name is 2-[6,8,17,19-tetraoxo-18-(2-sulfoethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl]ethanesulfonate.
| Compound Name | 2-[6,8,17,19-tetraoxo-18-(2-sulfoethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl]ethanesulfonate |
|---|---|
| PubChem CID | 176556728 |
| Molecular Formula | C28H17N2O10S2- |
| Molecular Weight | 605.58 g/mol |
| Exact Mass | 605.03 |
| IUPAC Name | 2-[6,8,17,19-tetraoxo-18-(2-sulfoethyl)-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaen-7-yl]ethanesulfonate |
| SMILES | O=C1c2ccc3c4ccc5c6c(ccc(c7ccc(c2c37)C(=O)N1CCS(=O)(=O)[O-])c64)C(=O)N(CCS(=O)(=O)O)C5=O |
| InChI | InChI=1S/C28H18N2O10S2/c31-25-17-5-1-13-14-2-6-19-24-20(28(34)30(27(19)33)10-12-42(38,39)40)8-4-16(22(14)24)15-3-7-18(23(17)21(13)15)26(32)29(25)9-11-41(35,36)37/h1-8H,9-12H2,(H,35,36,37)(H,38,39,40)/p-1 |
| InChIKey | GGPDBTJQWSWHIX-UHFFFAOYSA-M |
| XLogP | 2.36 |
| TPSA | 186.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.58 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|