C17H15FN2O5S — CID 113082397
N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 113082397) has the molecular formula C17H15FN2O5S and a molecular weight of 378.38 g/mol. Its IUPAC name is N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113082397 |
| Molecular Formula | C17H15FN2O5S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCN2C(=O)c3cccc(F)c3C2=O)cc1 |
| InChI | InChI=1S/C17H15FN2O5S/c1-25-11-5-7-12(8-6-11)26(23,24)19-9-10-20-16(21)13-3-2-4-14(18)15(13)17(20)22/h2-8,19H,9-10H2,1H3 |
| InChIKey | BXEHTJQHNIQCQE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|