C18H17ClN2O4S — CID 113082089
N-[2-(4-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 113082089) has the molecular formula C18H17ClN2O4S and a molecular weight of 392.86 g/mol. Its IUPAC name is N-[2-(4-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(4-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113082089 |
| Molecular Formula | C18H17ClN2O4S |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[2-(4-chloro-1,3-dioxoisoindol-2-yl)ethyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCN2C(=O)c3cccc(Cl)c3C2=O)cc1C |
| InChI | InChI=1S/C18H17ClN2O4S/c1-11-6-7-13(10-12(11)2)26(24,25)20-8-9-21-17(22)14-4-3-5-15(19)16(14)18(21)23/h3-7,10,20H,8-9H2,1-2H3 |
| InChIKey | LGPHDHPZMDKHND-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|