2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride

C10H14ClNO4S2 — CID 81357871

IUPAC2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride
SMILESCc1ccc(S(=O)(=O)NCCS(=O)(=O)Cl)cc1C
InChIInChI=1S/C10H14ClNO4S2/c1-8-3-4-10(7-9(8)2)18(15,16)12-5-6-17(11,13)14/h3-4,7,12H,5-6H2,1-2H3
InChIKeyVJDGSFJQMNZUSS-UHFFFAOYSA-N
MW311.81 g/mol
LogP1.15
Rot. Bonds5

About 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride

2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride (PubChem CID 81357871) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride.

Molecular Properties

Compound Name2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride
PubChem CID81357871
Molecular FormulaC10H14ClNO4S2
Molecular Weight311.81 g/mol
Exact Mass311.01
IUPAC Name2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride
SMILESCc1ccc(S(=O)(=O)NCCS(=O)(=O)Cl)cc1C
InChIInChI=1S/C10H14ClNO4S2/c1-8-3-4-10(7-9(8)2)18(15,16)12-5-6-17(11,13)14/h3-4,7,12H,5-6H2,1-2H3
InChIKeyVJDGSFJQMNZUSS-UHFFFAOYSA-N
XLogP1.15
TPSA80.31 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500311.81
LogP ≤ 51.15
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride?
The IUPAC name of 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride (CID 81357871) is 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride.
What is the SMILES notation for 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride?
The canonical SMILES for 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride is Cc1ccc(S(=O)(=O)NCCS(=O)(=O)Cl)cc1C.
What is the InChIKey of 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride?
The InChIKey is VJDGSFJQMNZUSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14ClNO4S2/c1-8-3-4-10(7-9(8)2)18(15,16)12-5-6-17(11,13)14/h3-4,7,12H,5-6H2,1-2H3.
What are the key properties of 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride?
2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride has a molecular weight of 311.81 g/mol, XLogP of 1.15, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride is sourced from PubChem (CID 81357871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).