C10H14ClNO4S2 — CID 81357871
2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride (PubChem CID 81357871) has the molecular formula C10H14ClNO4S2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride.
| Compound Name | 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride |
|---|---|
| PubChem CID | 81357871 |
| Molecular Formula | C10H14ClNO4S2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2-[(3,4-dimethylphenyl)sulfonylamino]ethanesulfonyl chloride |
| SMILES | Cc1ccc(S(=O)(=O)NCCS(=O)(=O)Cl)cc1C |
| InChI | InChI=1S/C10H14ClNO4S2/c1-8-3-4-10(7-9(8)2)18(15,16)12-5-6-17(11,13)14/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | VJDGSFJQMNZUSS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |