C18H23NO2S2 — CID 141168989
N-[2-(4-ethylphenyl)sulfanylethyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 141168989) has the molecular formula C18H23NO2S2 and a molecular weight of 349.52 g/mol. Its IUPAC name is N-[2-(4-ethylphenyl)sulfanylethyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[2-(4-ethylphenyl)sulfanylethyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 141168989 |
| Molecular Formula | C18H23NO2S2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-[2-(4-ethylphenyl)sulfanylethyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | CCc1ccc(SCCNS(=O)(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C18H23NO2S2/c1-4-16-6-8-17(9-7-16)22-12-11-19-23(20,21)18-10-5-14(2)15(3)13-18/h5-10,13,19H,4,11-12H2,1-3H3 |
| InChIKey | QRPWGMBMLANQAE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|