C19H22F3NO5S2 — CID 161044678
methyl 2-ethyl-5-[2-[4-(trifluoromethoxy)phenyl]sulfanylethylsulfamoyl]benzoate;molecular hydrogen (PubChem CID 161044678) has the molecular formula C19H22F3NO5S2 and a molecular weight of 465.52 g/mol. Its IUPAC name is methyl 2-ethyl-5-[2-[4-(trifluoromethoxy)phenyl]sulfanylethylsulfamoyl]benzoate;molecular hydrogen.
| Compound Name | methyl 2-ethyl-5-[2-[4-(trifluoromethoxy)phenyl]sulfanylethylsulfamoyl]benzoate;molecular hydrogen |
|---|---|
| PubChem CID | 161044678 |
| Molecular Formula | C19H22F3NO5S2 |
| Molecular Weight | 465.52 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | methyl 2-ethyl-5-[2-[4-(trifluoromethoxy)phenyl]sulfanylethylsulfamoyl]benzoate;molecular hydrogen |
| SMILES | CCc1ccc(S(=O)(=O)NCCSc2ccc(OC(F)(F)F)cc2)cc1C(=O)OC.[H][H] |
| InChI | InChI=1S/C19H20F3NO5S2.H2/c1-3-13-4-9-16(12-17(13)18(24)27-2)30(25,26)23-10-11-29-15-7-5-14(6-8-15)28-19(20,21)22;/h4-9,12,23H,3,10-11H2,1-2H3;1H |
| InChIKey | UBINTLMJVIRZSO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.52 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|