C24H22F3NO6S — CID 69235853
methyl 5-[ethyl-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfamoyl]-2-methylbenzoate (PubChem CID 69235853) has the molecular formula C24H22F3NO6S and a molecular weight of 509.50 g/mol. Its IUPAC name is methyl 5-[ethyl-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[ethyl-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 69235853 |
| Molecular Formula | C24H22F3NO6S |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | methyl 5-[ethyl-[4-[4-(trifluoromethoxy)phenoxy]phenyl]sulfamoyl]-2-methylbenzoate |
| SMILES | CCN(c1ccc(Oc2ccc(OC(F)(F)F)cc2)cc1)S(=O)(=O)c1ccc(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C24H22F3NO6S/c1-4-28(35(30,31)21-14-5-16(2)22(15-21)23(29)32-3)17-6-8-18(9-7-17)33-19-10-12-20(13-11-19)34-24(25,26)27/h5-15H,4H2,1-3H3 |
| InChIKey | ACJCNVQENFRNMC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |