C23H24N2O5S — CID 69236510
methyl 5-[ethyl-(4-pyridin-4-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoate (PubChem CID 69236510) has the molecular formula C23H24N2O5S and a molecular weight of 440.52 g/mol. Its IUPAC name is methyl 5-[ethyl-(4-pyridin-4-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoate.
| Compound Name | methyl 5-[ethyl-(4-pyridin-4-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 69236510 |
| Molecular Formula | C23H24N2O5S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | methyl 5-[ethyl-(4-pyridin-4-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoate |
| SMILES | CCN(c1ccc(Oc2ccncc2)cc1)S(=O)(=O)c1cc(C)c(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C23H24N2O5S/c1-5-25(18-6-8-19(9-7-18)30-20-10-12-24-13-11-20)31(27,28)21-14-16(2)17(3)22(15-21)23(26)29-4/h6-15H,5H2,1-4H3 |
| InChIKey | VKEVHNZPPFYVLG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |