C22H22N2O5S — CID 69236581
5-[ethyl-(4-pyridin-3-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoic acid (PubChem CID 69236581) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is 5-[ethyl-(4-pyridin-3-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[ethyl-(4-pyridin-3-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 69236581 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 5-[ethyl-(4-pyridin-3-yloxyphenyl)sulfamoyl]-2,3-dimethylbenzoic acid |
| SMILES | CCN(c1ccc(Oc2cccnc2)cc1)S(=O)(=O)c1cc(C)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C22H22N2O5S/c1-4-24(17-7-9-18(10-8-17)29-19-6-5-11-23-14-19)30(27,28)20-12-15(2)16(3)21(13-20)22(25)26/h5-14H,4H2,1-3H3,(H,25,26) |
| InChIKey | ANLDAFHHKODLEM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |