C20H21F4NO5S — CID 87744634
5-[ethyl-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid (PubChem CID 87744634) has the molecular formula C20H21F4NO5S and a molecular weight of 463.45 g/mol. Its IUPAC name is 5-[ethyl-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid.
| Compound Name | 5-[ethyl-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 87744634 |
| Molecular Formula | C20H21F4NO5S |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 5-[ethyl-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]sulfamoyl]-2,3-dimethylbenzoic acid |
| SMILES | CCN(c1ccc(OCC(F)(F)C(F)F)cc1)S(=O)(=O)c1cc(C)c(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C20H21F4NO5S/c1-4-25(14-5-7-15(8-6-14)30-11-20(23,24)19(21)22)31(28,29)16-9-12(2)13(3)17(10-16)18(26)27/h5-10,19H,4,11H2,1-3H3,(H,26,27) |
| InChIKey | QOOGSISOVSWBSB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|