C25H27NO6S2 — CID 87746120
methyl 5-[ethyl-[4-(4-methoxyphenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoate (PubChem CID 87746120) has the molecular formula C25H27NO6S2 and a molecular weight of 501.63 g/mol. Its IUPAC name is methyl 5-[ethyl-[4-(4-methoxyphenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoate.
| Compound Name | methyl 5-[ethyl-[4-(4-methoxyphenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 87746120 |
| Molecular Formula | C25H27NO6S2 |
| Molecular Weight | 501.63 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | methyl 5-[ethyl-[4-(4-methoxyphenoxy)phenyl]sulfanylsulfamoyl]-2,3-dimethylbenzoate |
| SMILES | CCN(Sc1ccc(Oc2ccc(OC)cc2)cc1)S(=O)(=O)c1cc(C)c(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C25H27NO6S2/c1-6-26(34(28,29)23-15-17(2)18(3)24(16-23)25(27)31-5)33-22-13-11-21(12-14-22)32-20-9-7-19(30-4)8-10-20/h7-16H,6H2,1-5H3 |
| InChIKey | MFSLFXULUSAIAU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.63 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|