C19H19ClN2O4S3 — CID 87745941
methyl 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2,3-dimethylbenzoate (PubChem CID 87745941) has the molecular formula C19H19ClN2O4S3 and a molecular weight of 471.03 g/mol. Its IUPAC name is methyl 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2,3-dimethylbenzoate.
| Compound Name | methyl 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2,3-dimethylbenzoate |
|---|---|
| PubChem CID | 87745941 |
| Molecular Formula | C19H19ClN2O4S3 |
| Molecular Weight | 471.03 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | methyl 5-[(5-chloro-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2,3-dimethylbenzoate |
| SMILES | CCN(Sc1nc2cc(Cl)ccc2s1)S(=O)(=O)c1cc(C)c(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C19H19ClN2O4S3/c1-5-22(28-19-21-16-9-13(20)6-7-17(16)27-19)29(24,25)14-8-11(2)12(3)15(10-14)18(23)26-4/h6-10H,5H2,1-4H3 |
| InChIKey | CNJACXHWMCODCB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.03 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|