C20H22N2O5S3 — CID 87746792
methyl 5-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate (PubChem CID 87746792) has the molecular formula C20H22N2O5S3 and a molecular weight of 466.61 g/mol. Its IUPAC name is methyl 5-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 87746792 |
| Molecular Formula | C20H22N2O5S3 |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | methyl 5-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate |
| SMILES | CCOc1ccc2nc(SN(CC)S(=O)(=O)c3ccc(C)c(C(=O)OC)c3)sc2c1 |
| InChI | InChI=1S/C20H22N2O5S3/c1-5-22(29-20-21-17-10-8-14(27-6-2)11-18(17)28-20)30(24,25)15-9-7-13(3)16(12-15)19(23)26-4/h7-12H,5-6H2,1-4H3 |
| InChIKey | FLKTWCFRQAAXLC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|