C21H27NO4S2 — CID 87745404
methyl 5-[(4-tert-butylphenyl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate (PubChem CID 87745404) has the molecular formula C21H27NO4S2 and a molecular weight of 421.58 g/mol. Its IUPAC name is methyl 5-[(4-tert-butylphenyl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[(4-tert-butylphenyl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 87745404 |
| Molecular Formula | C21H27NO4S2 |
| Molecular Weight | 421.58 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | methyl 5-[(4-tert-butylphenyl)sulfanyl-ethylsulfamoyl]-2-methylbenzoate |
| SMILES | CCN(Sc1ccc(C(C)(C)C)cc1)S(=O)(=O)c1ccc(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C21H27NO4S2/c1-7-22(27-17-11-9-16(10-12-17)21(3,4)5)28(24,25)18-13-8-15(2)19(14-18)20(23)26-6/h8-14H,7H2,1-6H3 |
| InChIKey | MUSQLSVJNCNGDZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.58 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|