C18H21NO4S2 — CID 87745897
5-[ethyl-(4-ethylphenyl)sulfanylsulfamoyl]-2-methylbenzoic acid (PubChem CID 87745897) has the molecular formula C18H21NO4S2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 5-[ethyl-(4-ethylphenyl)sulfanylsulfamoyl]-2-methylbenzoic acid.
| Compound Name | 5-[ethyl-(4-ethylphenyl)sulfanylsulfamoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 87745897 |
| Molecular Formula | C18H21NO4S2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 5-[ethyl-(4-ethylphenyl)sulfanylsulfamoyl]-2-methylbenzoic acid |
| SMILES | CCc1ccc(SN(CC)S(=O)(=O)c2ccc(C)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C18H21NO4S2/c1-4-14-7-9-15(10-8-14)24-19(5-2)25(22,23)16-11-6-13(3)17(12-16)18(20)21/h6-12H,4-5H2,1-3H3,(H,20,21) |
| InChIKey | PQGLPCJMPDZUTK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|