C17H17F3N2O4S2 — CID 87746321
2-ethyl-5-[ethyl-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]sulfamoyl]benzoic acid (PubChem CID 87746321) has the molecular formula C17H17F3N2O4S2 and a molecular weight of 434.46 g/mol. Its IUPAC name is 2-ethyl-5-[ethyl-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]sulfamoyl]benzoic acid.
| Compound Name | 2-ethyl-5-[ethyl-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 87746321 |
| Molecular Formula | C17H17F3N2O4S2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | 2-ethyl-5-[ethyl-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]sulfamoyl]benzoic acid |
| SMILES | CCc1ccc(S(=O)(=O)N(CC)Sc2ccc(C(F)(F)F)cn2)cc1C(=O)O |
| InChI | InChI=1S/C17H17F3N2O4S2/c1-3-11-5-7-13(9-14(11)16(23)24)28(25,26)22(4-2)27-15-8-6-12(10-21-15)17(18,19)20/h5-10H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | VAEWWFDXPGOPGU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|