C20H16F3NO4S — CID 174508728
4-[[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]methyl]naphthalene-1-carboxylic acid (PubChem CID 174508728) has the molecular formula C20H16F3NO4S and a molecular weight of 423.41 g/mol. Its IUPAC name is 4-[[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]methyl]naphthalene-1-carboxylic acid.
| Compound Name | 4-[[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]methyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 174508728 |
| Molecular Formula | C20H16F3NO4S |
| Molecular Weight | 423.41 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | 4-[[methyl-[4-(trifluoromethyl)phenyl]sulfonylamino]methyl]naphthalene-1-carboxylic acid |
| SMILES | CN(Cc1ccc(C(=O)O)c2ccccc12)S(=O)(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3NO4S/c1-24(29(27,28)15-9-7-14(8-10-15)20(21,22)23)12-13-6-11-18(19(25)26)17-5-3-2-4-16(13)17/h2-11H,12H2,1H3,(H,25,26) |
| InChIKey | ZAENHEFZEAZKRD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |